C20H19BrN2O4 — CID 21229972
(4S)-4-(3-bromo-4,5-dimethoxyphenyl)-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 21229972) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is (4S)-4-(3-bromo-4,5-dimethoxyphenyl)-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (4S)-4-(3-bromo-4,5-dimethoxyphenyl)-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 21229972 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (4S)-4-(3-bromo-4,5-dimethoxyphenyl)-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@H]2Nc3c(cccc3[N+](=O)[O-])C3C=CCC32)cc(Br)c1OC |
| InChI | InChI=1S/C20H19BrN2O4/c1-26-17-10-11(9-15(21)20(17)27-2)18-13-6-3-5-12(13)14-7-4-8-16(23(24)25)19(14)22-18/h3-5,7-10,12-13,18,22H,6H2,1-2H3/t12?,13?,18-/m1/s1 |
| InChIKey | NUDPKGCOKVZIDG-PWGQDJSOSA-N |
| XLogP | 5.20 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|