C22H23BrN2O4 — CID 41201493
(3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 41201493) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 41201493 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c([N+](=O)[O-])cc(C)c(C)c3[C@@H]3C=CC[C@@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C22H23BrN2O4/c1-11-8-17(25(26)27)21-19(12(11)2)14-6-5-7-15(14)20(24-21)13-9-16(23)22(29-4)18(10-13)28-3/h5-6,8-10,14-15,20,24H,7H2,1-4H3/t14-,15+,20+/m1/s1 |
| InChIKey | KPLZRNSAZFTQBY-SIFCLUCFSA-N |
| XLogP | 5.82 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|