C20H19BrN2O2 — CID 22193820
(3aS,4R,9bR)-4-(3-bromophenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 22193820) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3-bromophenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3-bromophenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 22193820 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (3aS,4R,9bR)-4-(3-bromophenyl)-8,9-dimethyl-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc([N+](=O)[O-])c2c(c1C)[C@@H]1C=CC[C@@H]1[C@H](c1cccc(Br)c1)N2 |
| InChI | InChI=1S/C20H19BrN2O2/c1-11-9-17(23(24)25)20-18(12(11)2)15-7-4-8-16(15)19(22-20)13-5-3-6-14(21)10-13/h3-7,9-10,15-16,19,22H,8H2,1-2H3/t15-,16+,19+/m1/s1 |
| InChIKey | MXYBEMHMIWYYHF-GJYPPUQNSA-N |
| XLogP | 5.80 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|