C21H21BrN2O4 — CID 41201433
(3aR,4R,9bS)-4-(3-bromo-4,5-dimethoxyphenyl)-6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 41201433) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is (3aR,4R,9bS)-4-(3-bromo-4,5-dimethoxyphenyl)-6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bS)-4-(3-bromo-4,5-dimethoxyphenyl)-6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 41201433 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | (3aR,4R,9bS)-4-(3-bromo-4,5-dimethoxyphenyl)-6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(C)cc([N+](=O)[O-])cc3[C@H]3C=CC[C@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C21H21BrN2O4/c1-11-7-13(24(25)26)10-16-14-5-4-6-15(14)20(23-19(11)16)12-8-17(22)21(28-3)18(9-12)27-2/h4-5,7-10,14-15,20,23H,6H2,1-3H3/t14-,15+,20-/m0/s1 |
| InChIKey | HDILAOFDMAEPHF-MDOVXXIYSA-N |
| XLogP | 5.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|