C26H22BrClN2O4 — CID 126174023
(3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-chloro-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126174023) has the molecular formula C26H22BrClN2O4 and a molecular weight of 541.83 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-chloro-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-chloro-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126174023 |
| Molecular Formula | C26H22BrClN2O4 |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-chloro-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)cc([N+](=O)[O-])cc3[C@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H22BrClN2O4/c1-33-23-11-16(10-21(27)26(23)34-14-15-6-3-2-4-7-15)24-19-9-5-8-18(19)20-12-17(30(31)32)13-22(28)25(20)29-24/h2-8,10-13,18-19,24,29H,9,14H2,1H3/t18-,19-,24-/m0/s1 |
| InChIKey | JWFQSVCXQZWRGZ-JXQFQVJHSA-N |
| XLogP | 7.42 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|