C27H24BrClN2O5 — CID 126178441
(3aS,4S,9bS)-4-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126178441) has the molecular formula C27H24BrClN2O5 and a molecular weight of 571.86 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bS)-4-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126178441 |
| Molecular Formula | C27H24BrClN2O5 |
| Molecular Weight | 571.86 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (3aS,4S,9bS)-4-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([N+](=O)[O-])cc2c1N[C@H](c1cc(Br)c(OCc3ccc(Cl)cc3)c(OC)c1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C27H24BrClN2O5/c1-34-23-13-18(31(32)33)12-21-19-4-3-5-20(19)25(30-26(21)23)16-10-22(28)27(24(11-16)35-2)36-14-15-6-8-17(29)9-7-15/h3-4,6-13,19-20,25,30H,5,14H2,1-2H3/t19-,20-,25+/m0/s1 |
| InChIKey | IVNOPQMUNMBNOC-ZYLNGJIFSA-N |
| XLogP | 7.43 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.86 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|