C21H18BrClF3NO2 — CID 126166590
(3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126166590) has the molecular formula C21H18BrClF3NO2 and a molecular weight of 488.73 g/mol. Its IUPAC name is (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126166590 |
| Molecular Formula | C21H18BrClF3NO2 |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)ccc(C(F)(F)F)c3[C@@H]3C=CC[C@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C21H18BrClF3NO2/c1-28-16-9-10(8-14(22)20(16)29-2)18-12-5-3-4-11(12)17-13(21(24,25)26)6-7-15(23)19(17)27-18/h3-4,6-9,11-12,18,27H,5H2,1-2H3/t11-,12-,18+/m1/s1 |
| InChIKey | UCNUHDNDKHBECT-FMTVUPSXSA-N |
| XLogP | 6.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|