C27H21BrCl2F3NO2 — CID 126163577
(3aS,4R,9bS)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126163577) has the molecular formula C27H21BrCl2F3NO2 and a molecular weight of 599.27 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126163577 |
| Molecular Formula | C27H21BrCl2F3NO2 |
| Molecular Weight | 599.27 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | (3aS,4R,9bS)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)ccc(C(F)(F)F)c3[C@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H21BrCl2F3NO2/c1-35-22-12-15(11-19(28)26(22)36-13-14-5-2-3-8-20(14)29)24-17-7-4-6-16(17)23-18(27(31,32)33)9-10-21(30)25(23)34-24/h2-6,8-12,16-17,24,34H,7,13H2,1H3/t16-,17-,24-/m0/s1 |
| InChIKey | IFHGLSCCTMRJAZ-UAVUOLJFSA-N |
| XLogP | 9.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.27 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|