C27H24BrCl2NO2 — CID 126172553
(3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126172553) has the molecular formula C27H24BrCl2NO2 and a molecular weight of 545.30 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126172553 |
| Molecular Formula | C27H24BrCl2NO2 |
| Molecular Weight | 545.30 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-8-chloro-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(C)cc(Cl)cc3[C@@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H24BrCl2NO2/c1-15-10-18(29)13-21-19-7-5-8-20(19)26(31-25(15)21)17-11-22(28)27(24(12-17)32-2)33-14-16-6-3-4-9-23(16)30/h3-7,9-13,19-20,26,31H,8,14H2,1-2H3/t19-,20+,26+/m1/s1 |
| InChIKey | CMNWAFZHQGQGLW-GOHWNWGWSA-N |
| XLogP | 8.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.30 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|