C26H21Br2ClFNO2 — CID 126157603
(3aS,4R,9bR)-8-bromo-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126157603) has the molecular formula C26H21Br2ClFNO2 and a molecular weight of 593.72 g/mol. Its IUPAC name is (3aS,4R,9bR)-8-bromo-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-8-bromo-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126157603 |
| Molecular Formula | C26H21Br2ClFNO2 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 590.96 |
| IUPAC Name | (3aS,4R,9bR)-8-bromo-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(F)cc(Br)cc3[C@@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H21Br2ClFNO2/c1-32-23-10-15(9-20(28)26(23)33-13-14-5-2-3-8-21(14)29)24-18-7-4-6-17(18)19-11-16(27)12-22(30)25(19)31-24/h2-6,8-12,17-18,24,31H,7,13H2,1H3/t17-,18+,24+/m1/s1 |
| InChIKey | BCTDZRNQGOWDHJ-YTZAWJCFSA-N |
| XLogP | 8.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|