C29H27BrClNO4 — CID 126156396
methyl (3aR,4S,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate (PubChem CID 126156396) has the molecular formula C29H27BrClNO4 and a molecular weight of 568.90 g/mol. Its IUPAC name is methyl (3aR,4S,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate.
| Compound Name | methyl (3aR,4S,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 126156396 |
| Molecular Formula | C29H27BrClNO4 |
| Molecular Weight | 568.90 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | methyl (3aR,4S,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1C)N[C@H](c1cc(Br)c(OCc3ccccc3Cl)c(OC)c1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C29H27BrClNO4/c1-16-19(29(33)35-3)11-12-22-20-8-6-9-21(20)27(32-26(16)22)18-13-23(30)28(25(14-18)34-2)36-15-17-7-4-5-10-24(17)31/h4-8,10-14,20-21,27,32H,9,15H2,1-3H3/t20-,21-,27-/m1/s1 |
| InChIKey | AGTXMXLQUHZJQT-LGVUCKNBSA-N |
| XLogP | 7.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.90 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|