C28H25BrClNO4 — CID 126166695
(3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid (PubChem CID 126166695) has the molecular formula C28H25BrClNO4 and a molecular weight of 554.87 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid.
| Compound Name | (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 126166695 |
| Molecular Formula | C28H25BrClNO4 |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | (3aS,4R,9bR)-4-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
| SMILES | COc1cc([C@@H]2Nc3c(C)ccc(C(=O)O)c3[C@@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C28H25BrClNO4/c1-15-10-11-20(28(32)33)24-18-7-5-8-19(18)26(31-25(15)24)17-12-21(29)27(23(13-17)34-2)35-14-16-6-3-4-9-22(16)30/h3-7,9-13,18-19,26,31H,8,14H2,1-2H3,(H,32,33)/t18-,19+,26+/m1/s1 |
| InChIKey | WYLJNVVWUPUHSW-MVYHEMRASA-N |
| XLogP | 7.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|