C28H26BrNO4 — CID 126156552
(3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid (PubChem CID 126156552) has the molecular formula C28H26BrNO4 and a molecular weight of 520.42 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid.
| Compound Name | (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 126156552 |
| Molecular Formula | C28H26BrNO4 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | (3aS,4R,9bS)-4-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-6-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
| SMILES | COc1cc([C@@H]2Nc3c(C)ccc(C(=O)O)c3[C@H]3C=CC[C@@H]32)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H26BrNO4/c1-16-11-12-21(28(31)32)24-19-9-6-10-20(19)26(30-25(16)24)18-13-22(29)27(23(14-18)33-2)34-15-17-7-4-3-5-8-17/h3-9,11-14,19-20,26,30H,10,15H2,1-2H3,(H,31,32)/t19-,20-,26-/m0/s1 |
| InChIKey | ASHHDKHZEAFJJR-DYLHXGEVSA-N |
| XLogP | 6.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|