C19H18N2O2 — CID 126166329
(3aR,4S,9bR)-6-methyl-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid (PubChem CID 126166329) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3aR,4S,9bR)-6-methyl-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid.
| Compound Name | (3aR,4S,9bR)-6-methyl-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 126166329 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3aR,4S,9bR)-6-methyl-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-9-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c1N[C@H](c1ccncc1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C19H18N2O2/c1-11-5-6-15(19(22)23)16-13-3-2-4-14(13)18(21-17(11)16)12-7-9-20-10-8-12/h2-3,5-10,13-14,18,21H,4H2,1H3,(H,22,23)/t13-,14-,18-/m1/s1 |
| InChIKey | SEZXZEIICNDHAK-HBUWYVDXSA-N |
| XLogP | 3.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|