C27H20BrCl3F3NO2 — CID 126159318
(3aR,4R,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126159318) has the molecular formula C27H20BrCl3F3NO2 and a molecular weight of 633.72 g/mol. Its IUPAC name is (3aR,4R,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126159318 |
| Molecular Formula | C27H20BrCl3F3NO2 |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 630.97 |
| IUPAC Name | (3aR,4R,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-chloro-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)ccc(C(F)(F)F)c3[C@@H]3C=CC[C@H]32)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H20BrCl3F3NO2/c1-36-22-11-14(10-18(28)26(22)37-12-13-5-7-19(29)21(31)9-13)24-16-4-2-3-15(16)23-17(27(32,33)34)6-8-20(30)25(23)35-24/h2-3,5-11,15-16,24,35H,4,12H2,1H3/t15-,16-,24+/m1/s1 |
| InChIKey | KNUFDWDYVRYXRG-JOWJHRDDSA-N |
| XLogP | 9.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|