C27H23BrCl2N2O5 — CID 126169266
(3aS,4S,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126169266) has the molecular formula C27H23BrCl2N2O5 and a molecular weight of 606.30 g/mol. Its IUPAC name is (3aS,4S,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126169266 |
| Molecular Formula | C27H23BrCl2N2O5 |
| Molecular Weight | 606.30 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | (3aS,4S,9bR)-4-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-6-methoxy-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1ccc([N+](=O)[O-])c2c1N[C@H](c1cc(Br)c(OCc3ccc(Cl)c(Cl)c3)c(OC)c1)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C27H23BrCl2N2O5/c1-35-22-9-8-21(32(33)34)24-16-4-3-5-17(16)25(31-26(22)24)15-11-18(28)27(23(12-15)36-2)37-13-14-6-7-19(29)20(30)10-14/h3-4,6-12,16-17,25,31H,5,13H2,1-2H3/t16-,17+,25-/m1/s1 |
| InChIKey | KIIZFDMKGYPYDU-LEHBWIKQSA-N |
| XLogP | 8.09 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.30 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|