C20H17ClF3NO — CID 126165461
(3aR,4R,9bR)-6-chloro-4-(3-methoxyphenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126165461) has the molecular formula C20H17ClF3NO and a molecular weight of 379.81 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-chloro-4-(3-methoxyphenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-6-chloro-4-(3-methoxyphenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126165461 |
| Molecular Formula | C20H17ClF3NO |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (3aR,4R,9bR)-6-chloro-4-(3-methoxyphenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cccc([C@@H]2Nc3c(Cl)ccc(C(F)(F)F)c3[C@@H]3C=CC[C@H]32)c1 |
| InChI | InChI=1S/C20H17ClF3NO/c1-26-12-5-2-4-11(10-12)18-14-7-3-6-13(14)17-15(20(22,23)24)8-9-16(21)19(17)25-18/h2-6,8-10,13-14,18,25H,7H2,1H3/t13-,14-,18+/m1/s1 |
| InChIKey | QGDYQRUFKHVBSY-LBTNJELSSA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|