C19H14ClF4N — CID 126174741
(3aR,4R,9bR)-6-chloro-4-(4-fluorophenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126174741) has the molecular formula C19H14ClF4N and a molecular weight of 367.77 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-chloro-4-(4-fluorophenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-6-chloro-4-(4-fluorophenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126174741 |
| Molecular Formula | C19H14ClF4N |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (3aR,4R,9bR)-6-chloro-4-(4-fluorophenyl)-9-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1ccc([C@@H]2Nc3c(Cl)ccc(C(F)(F)F)c3[C@@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C19H14ClF4N/c20-15-9-8-14(19(22,23)24)16-12-2-1-3-13(12)17(25-18(15)16)10-4-6-11(21)7-5-10/h1-2,4-9,12-13,17,25H,3H2/t12-,13-,17+/m1/s1 |
| InChIKey | MPTCQINAFVTKSV-XNJGSVPQSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|