C18H14Cl2FN — CID 7331636
(3aR,4S,9bR)-6,7-dichloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 7331636) has the molecular formula C18H14Cl2FN and a molecular weight of 334.22 g/mol. Its IUPAC name is (3aR,4S,9bR)-6,7-dichloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-6,7-dichloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 7331636 |
| Molecular Formula | C18H14Cl2FN |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (3aR,4S,9bR)-6,7-dichloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1ccc([C@H]2Nc3c(ccc(Cl)c3Cl)[C@@H]3C=CC[C@@H]23)cc1 |
| InChI | InChI=1S/C18H14Cl2FN/c19-15-9-8-14-12-2-1-3-13(12)17(22-18(14)16(15)20)10-4-6-11(21)7-5-10/h1-2,4-9,12-13,17,22H,3H2/t12-,13-,17-/m1/s1 |
| InChIKey | SVIXQZGYDRQRMJ-PBFPGSCMSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|