C20H16Cl2N2O — CID 7437938
2-[4-[(3aS,4S,9bR)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenoxy]acetonitrile (PubChem CID 7437938) has the molecular formula C20H16Cl2N2O and a molecular weight of 371.27 g/mol. Its IUPAC name is 2-[4-[(3aS,4S,9bR)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(3aS,4S,9bR)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 7437938 |
| Molecular Formula | C20H16Cl2N2O |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[4-[(3aS,4S,9bR)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc([C@H]2Nc3c(ccc(Cl)c3Cl)[C@@H]3C=CC[C@H]23)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O/c21-17-9-8-16-14-2-1-3-15(14)19(24-20(16)18(17)22)12-4-6-13(7-5-12)25-11-10-23/h1-2,4-9,14-15,19,24H,3,11H2/t14-,15+,19-/m1/s1 |
| InChIKey | ACERGHXZQNGUCY-ZRGWGRIASA-N |
| XLogP | 5.72 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|