C26H24ClNO — CID 23857125
(3aS,4S,9bR)-6-chloro-4-[4-[(4-methylphenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 23857125) has the molecular formula C26H24ClNO and a molecular weight of 401.94 g/mol. Its IUPAC name is (3aS,4S,9bR)-6-chloro-4-[4-[(4-methylphenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bR)-6-chloro-4-[4-[(4-methylphenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 23857125 |
| Molecular Formula | C26H24ClNO |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (3aS,4S,9bR)-6-chloro-4-[4-[(4-methylphenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc(COc2ccc([C@H]3Nc4c(Cl)cccc4[C@@H]4C=CC[C@H]34)cc2)cc1 |
| InChI | InChI=1S/C26H24ClNO/c1-17-8-10-18(11-9-17)16-29-20-14-12-19(13-15-20)25-22-5-2-4-21(22)23-6-3-7-24(27)26(23)28-25/h2-4,6-15,21-22,25,28H,5,16H2,1H3/t21-,22+,25-/m1/s1 |
| InChIKey | JKIBNJANVUIJOM-OTNCWRBYSA-N |
| XLogP | 7.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|