C25H21FN2O3 — CID 17387438
(3aS,4R,9bR)-6-fluoro-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17387438) has the molecular formula C25H21FN2O3 and a molecular weight of 416.45 g/mol. Its IUPAC name is (3aS,4R,9bR)-6-fluoro-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-6-fluoro-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17387438 |
| Molecular Formula | C25H21FN2O3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3aS,4R,9bR)-6-fluoro-4-[4-[(4-nitrophenyl)methoxy]phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccc(COc2ccc([C@@H]3Nc4c(F)cccc4[C@@H]4C=CC[C@@H]43)cc2)cc1 |
| InChI | InChI=1S/C25H21FN2O3/c26-23-6-2-5-22-20-3-1-4-21(20)24(27-25(22)23)17-9-13-19(14-10-17)31-15-16-7-11-18(12-8-16)28(29)30/h1-3,5-14,20-21,24,27H,4,15H2/t20-,21+,24+/m1/s1 |
| InChIKey | DSKUKJMTMICQRP-DPLHUUCSSA-N |
| XLogP | 6.14 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|