C25H21ClN2O3 — CID 21215799
(4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 21215799) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 21215799 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1cccc2c1N[C@H](c1ccc(OCc3ccc(Cl)cc3)cc1)C1CC=CC21 |
| InChI | InChI=1S/C25H21ClN2O3/c26-18-11-7-16(8-12-18)15-31-19-13-9-17(10-14-19)24-21-4-1-3-20(21)22-5-2-6-23(28(29)30)25(22)27-24/h1-3,5-14,20-21,24,27H,4,15H2/t20?,21?,24-/m1/s1 |
| InChIKey | UPFVOOAXTZUYRN-SLXFGWRHSA-N |
| XLogP | 6.65 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|