C26H21ClF3NO — CID 21215672
(4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 21215672) has the molecular formula C26H21ClF3NO and a molecular weight of 455.91 g/mol. Its IUPAC name is (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 21215672 |
| Molecular Formula | C26H21ClF3NO |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (4S)-4-[4-[(4-chlorophenyl)methoxy]phenyl]-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | FC(F)(F)c1cccc2c1N[C@H](c1ccc(OCc3ccc(Cl)cc3)cc1)C1CC=CC21 |
| InChI | InChI=1S/C26H21ClF3NO/c27-18-11-7-16(8-12-18)15-32-19-13-9-17(10-14-19)24-21-4-1-3-20(21)22-5-2-6-23(25(22)31-24)26(28,29)30/h1-3,5-14,20-21,24,31H,4,15H2/t20?,21?,24-/m1/s1 |
| InChIKey | GSDCUCIAFVJDAG-SLXFGWRHSA-N |
| XLogP | 7.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|