C26H21ClNO3- — CID 6567155
(3aS,4R,9bS)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 6567155) has the molecular formula C26H21ClNO3- and a molecular weight of 430.91 g/mol. Its IUPAC name is (3aS,4R,9bS)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | (3aS,4R,9bS)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 6567155 |
| Molecular Formula | C26H21ClNO3- |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (3aS,4R,9bS)-6-chloro-4-(4-phenylmethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | O=C([O-])c1cc(Cl)c2c(c1)[C@H]1C=CC[C@@H]1[C@H](c1ccc(OCc3ccccc3)cc1)N2 |
| InChI | InChI=1S/C26H22ClNO3/c27-23-14-18(26(29)30)13-22-20-7-4-8-21(20)24(28-25(22)23)17-9-11-19(12-10-17)31-15-16-5-2-1-3-6-16/h1-7,9-14,20-21,24,28H,8,15H2,(H,29,30)/p-1/t20-,21-,24-/m0/s1 |
| InChIKey | DJUGLURHSYCLHC-HFMPRLQTSA-M |
| XLogP | 5.11 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|