C20H19Cl2NO — CID 17242151
6,8-dichloro-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17242151) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is 6,8-dichloro-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 6,8-dichloro-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17242151 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 6,8-dichloro-4-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCOc1ccc(C2Nc3c(Cl)cc(Cl)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C20H19Cl2NO/c1-2-24-14-8-6-12(7-9-14)19-16-5-3-4-15(16)17-10-13(21)11-18(22)20(17)23-19/h3-4,6-11,15-16,19,23H,2,5H2,1H3 |
| InChIKey | CWURJMZABCIAKG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|