C21H21Cl2NO3 — CID 7437909
(3aR,4S,9bR)-6,8-dichloro-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 7437909) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is (3aR,4S,9bR)-6,8-dichloro-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-6,8-dichloro-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 7437909 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (3aR,4S,9bR)-6,8-dichloro-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@H]2Nc3c(Cl)cc(Cl)cc3[C@@H]3C=CC[C@@H]23)cc(OC)c1OC |
| InChI | InChI=1S/C21H21Cl2NO3/c1-25-17-7-11(8-18(26-2)21(17)27-3)19-14-6-4-5-13(14)15-9-12(22)10-16(23)20(15)24-19/h4-5,7-10,13-14,19,24H,6H2,1-3H3/t13-,14-,19-/m1/s1 |
| InChIKey | VSSFMNHIUGMXMU-PJIJBLCYSA-N |
| XLogP | 5.85 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|