C21H21Cl2N — CID 17239019
6,8-dichloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17239019) has the molecular formula C21H21Cl2N and a molecular weight of 358.31 g/mol. Its IUPAC name is 6,8-dichloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 6,8-dichloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17239019 |
| Molecular Formula | C21H21Cl2N |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 6,8-dichloro-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CC(C)c1ccc(C2Nc3c(Cl)cc(Cl)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C21H21Cl2N/c1-12(2)13-6-8-14(9-7-13)20-17-5-3-4-16(17)18-10-15(22)11-19(23)21(18)24-20/h3-4,6-12,16-17,20,24H,5H2,1-2H3 |
| InChIKey | JSUNBNZZPXRZCM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|