C23H27N — CID 17239027
6,8-dimethyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17239027) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is 6,8-dimethyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 6,8-dimethyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17239027 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 6,8-dimethyl-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(C)c2c(c1)C1C=CCC1C(c1ccc(C(C)C)cc1)N2 |
| InChI | InChI=1S/C23H27N/c1-14(2)17-8-10-18(11-9-17)23-20-7-5-6-19(20)21-13-15(3)12-16(4)22(21)24-23/h5-6,8-14,19-20,23-24H,7H2,1-4H3 |
| InChIKey | RYXPLNINXFDFGZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|