C21H22BrN — CID 40606821
(3aS,4R,9bS)-6-bromo-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 40606821) has the molecular formula C21H22BrN and a molecular weight of 368.32 g/mol. Its IUPAC name is (3aS,4R,9bS)-6-bromo-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-6-bromo-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 40606821 |
| Molecular Formula | C21H22BrN |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (3aS,4R,9bS)-6-bromo-4-(4-propan-2-ylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CC(C)c1ccc([C@@H]2Nc3c(Br)cccc3[C@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H22BrN/c1-13(2)14-9-11-15(12-10-14)20-17-6-3-5-16(17)18-7-4-8-19(22)21(18)23-20/h3-5,7-13,16-17,20,23H,6H2,1-2H3/t16-,17-,20-/m0/s1 |
| InChIKey | RROLBERKZZPWIA-ZWOKBUDYSA-N |
| XLogP | 6.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|