C17H15BrN2 — CID 7304906
(3aS,4S,9bS)-6-bromo-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 7304906) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is (3aS,4S,9bS)-6-bromo-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bS)-6-bromo-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 7304906 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (3aS,4S,9bS)-6-bromo-4-pyridin-4-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Brc1cccc2c1N[C@H](c1ccncc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C17H15BrN2/c18-15-6-2-5-14-12-3-1-4-13(12)16(20-17(14)15)11-7-9-19-10-8-11/h1-3,5-10,12-13,16,20H,4H2/t12-,13-,16+/m0/s1 |
| InChIKey | IFRQHBFWQRFPTC-HEHGZKQESA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|