C22H19ClNO3S- — CID 11923319
(3aS,4R,9bR)-6-chloro-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 11923319) has the molecular formula C22H19ClNO3S- and a molecular weight of 412.92 g/mol. Its IUPAC name is (3aS,4R,9bR)-6-chloro-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | (3aS,4R,9bR)-6-chloro-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 11923319 |
| Molecular Formula | C22H19ClNO3S- |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (3aS,4R,9bR)-6-chloro-4-[3-(thietan-3-yloxy)phenyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | O=C([O-])c1cc(Cl)c2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1cccc(OC3CSC3)c1)N2 |
| InChI | InChI=1S/C22H20ClNO3S/c23-19-9-13(22(25)26)8-18-16-5-2-6-17(16)20(24-21(18)19)12-3-1-4-14(7-12)27-15-10-28-11-15/h1-5,7-9,15-17,20,24H,6,10-11H2,(H,25,26)/p-1/t16-,17+,20+/m1/s1 |
| InChIKey | QVQLTGLMGZMBNW-UWVAXJGDSA-M |
| XLogP | 4.02 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|