C18H14BrCl2N — CID 11893943
(3aS,4S,9bS)-4-(4-bromophenyl)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 11893943) has the molecular formula C18H14BrCl2N and a molecular weight of 395.13 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(4-bromophenyl)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bS)-4-(4-bromophenyl)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 11893943 |
| Molecular Formula | C18H14BrCl2N |
| Molecular Weight | 395.13 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (3aS,4S,9bS)-4-(4-bromophenyl)-6,7-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1ccc2c(c1Cl)N[C@H](c1ccc(Br)cc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C18H14BrCl2N/c19-11-6-4-10(5-7-11)17-13-3-1-2-12(13)14-8-9-15(20)16(21)18(14)22-17/h1-2,4-9,12-13,17,22H,3H2/t12-,13-,17+/m0/s1 |
| InChIKey | CXKQYUCLXMIULC-GDZNZVCISA-N |
| XLogP | 6.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.13 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|