C22H25ClN2 — CID 17239339
4-(4-chlorophenyl)-N,N-diethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine (PubChem CID 17239339) has the molecular formula C22H25ClN2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-diethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine.
| Compound Name | 4-(4-chlorophenyl)-N,N-diethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine |
|---|---|
| PubChem CID | 17239339 |
| Molecular Formula | C22H25ClN2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-diethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine |
| SMILES | CCN(CC)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C22H25ClN2/c1-3-25(4-2)17-12-13-21-20(14-17)18-6-5-7-19(18)22(24-21)15-8-10-16(23)11-9-15/h5-6,8-14,18-19,22,24H,3-4,7H2,1-2H3 |
| InChIKey | QUOGQKUIRCKIJE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|