C22H22Cl2N2O3S — CID 110209040
4-[4-[(4R)-6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine (PubChem CID 110209040) has the molecular formula C22H22Cl2N2O3S and a molecular weight of 465.40 g/mol. Its IUPAC name is 4-[4-[(4R)-6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(4R)-6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 110209040 |
| Molecular Formula | C22H22Cl2N2O3S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[4-[(4R)-6,8-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc([C@@H]2Nc3c(Cl)cc(Cl)cc3C3C=CCC32)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H22Cl2N2O3S/c23-15-12-19-17-2-1-3-18(17)21(25-22(19)20(24)13-15)14-4-6-16(7-5-14)30(27,28)26-8-10-29-11-9-26/h1-2,4-7,12-13,17-18,21,25H,3,8-11H2/t17?,18?,21-/m0/s1 |
| InChIKey | GNZXMZWNKKKIFA-NGICGMGXSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|