C29H30N2O2S — CID 17237911
8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17237911) has the molecular formula C29H30N2O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17237911 |
| Molecular Formula | C29H30N2O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2,4,6-trimethylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(C)c(C2Nc3ccc(S(=O)(=O)N4CCc5ccccc54)cc3C3C=CCC32)c(C)c1 |
| InChI | InChI=1S/C29H30N2O2S/c1-18-15-19(2)28(20(3)16-18)29-24-9-6-8-23(24)25-17-22(11-12-26(25)30-29)34(32,33)31-14-13-21-7-4-5-10-27(21)31/h4-8,10-12,15-17,23-24,29-30H,9,13-14H2,1-3H3 |
| InChIKey | GXHGMGKVXBJISV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|