C28H28N2O3S — CID 17242693
8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17242693) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17242693 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 8-(2,3-dihydroindol-1-ylsulfonyl)-4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCOc1ccccc1C1Nc2ccc(S(=O)(=O)N3CCc4ccccc43)cc2C2C=CCC21 |
| InChI | InChI=1S/C28H28N2O3S/c1-2-33-27-13-6-4-9-23(27)28-22-11-7-10-21(22)24-18-20(14-15-25(24)29-28)34(31,32)30-17-16-19-8-3-5-12-26(19)30/h3-10,12-15,18,21-22,28-29H,2,11,16-17H2,1H3 |
| InChIKey | NVINFYCOXMYQFJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|