C18H16ClN3O4S — CID 17240137
4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17240137) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17240137 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-(4-chloro-3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)c([N+](=O)[O-])c1)N2 |
| InChI | InChI=1S/C18H16ClN3O4S/c19-15-6-4-10(8-17(15)22(23)24)18-13-3-1-2-12(13)14-9-11(27(20,25)26)5-7-16(14)21-18/h1-2,4-9,12-13,18,21H,3H2,(H2,20,25,26) |
| InChIKey | MXOQKIBVKBSVTH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|