C23H27N3O4S — CID 118682997
[4-[(3aR,4S,9bS)-8-sulfamoyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] N-tert-butylcarbamate (PubChem CID 118682997) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is [4-[(3aR,4S,9bS)-8-sulfamoyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] N-tert-butylcarbamate.
| Compound Name | [4-[(3aR,4S,9bS)-8-sulfamoyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 118682997 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [4-[(3aR,4S,9bS)-8-sulfamoyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]phenyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccc([C@H]2Nc3ccc(S(N)(=O)=O)cc3[C@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-23(2,3)26-22(27)30-15-9-7-14(8-10-15)21-18-6-4-5-17(18)19-13-16(31(24,28)29)11-12-20(19)25-21/h4-5,7-13,17-18,21,25H,6H2,1-3H3,(H,26,27)(H2,24,28,29)/t17-,18+,21+/m0/s1 |
| InChIKey | DVGSRZNIMPZBFT-WAOWUJCRSA-N |
| XLogP | 4.05 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|