C30H32N2O4 — CID 17237008
N-ethyl-N-phenyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17237008) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-ethyl-N-phenyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | N-ethyl-N-phenyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17237008 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-ethyl-N-phenyl-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CCN(C(=O)c1ccc2c(c1)C1C=CCC1C(c1cc(OC)c(OC)c(OC)c1)N2)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O4/c1-5-32(21-10-7-6-8-11-21)30(33)19-14-15-25-24(16-19)22-12-9-13-23(22)28(31-25)20-17-26(34-2)29(36-4)27(18-20)35-3/h6-12,14-18,22-23,28,31H,5,13H2,1-4H3 |
| InChIKey | PRYOJRUNRRQXRL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|