C27H25FN2O — CID 17243905
N-ethyl-4-(4-fluorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17243905) has the molecular formula C27H25FN2O and a molecular weight of 412.51 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17243905 |
| Molecular Formula | C27H25FN2O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CCN(C(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(F)cc1)N2)c1ccccc1 |
| InChI | InChI=1S/C27H25FN2O/c1-2-30(21-7-4-3-5-8-21)27(31)19-13-16-25-24(17-19)22-9-6-10-23(22)26(29-25)18-11-14-20(28)15-12-18/h3-9,11-17,22-23,26,29H,2,10H2,1H3 |
| InChIKey | FTUYWBVCPDSSIG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|