C28H28N2O2 — CID 17236375
N-ethyl-4-(4-methoxyphenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17236375) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-ethyl-4-(4-methoxyphenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-ethyl-4-(4-methoxyphenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17236375 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-ethyl-4-(4-methoxyphenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CCN(C(=O)c1cccc2c1NC(c1ccc(OC)cc1)C1CC=CC21)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c1-3-30(20-9-5-4-6-10-20)28(31)25-14-8-13-24-22-11-7-12-23(22)26(29-27(24)25)19-15-17-21(32-2)18-16-19/h4-11,13-18,22-23,26,29H,3,12H2,1-2H3 |
| InChIKey | OZGIEGSFSJTDEF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|