C28H28N2O — CID 17238105
N-benzyl-N-methyl-4-(4-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17238105) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(4-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-benzyl-N-methyl-4-(4-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17238105 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-benzyl-N-methyl-4-(4-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | Cc1ccc(C2Nc3c(C(=O)N(C)Cc4ccccc4)cccc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C28H28N2O/c1-19-14-16-21(17-15-19)26-23-11-6-10-22(23)24-12-7-13-25(27(24)29-26)28(31)30(2)18-20-8-4-3-5-9-20/h3-10,12-17,22-23,26,29H,11,18H2,1-2H3 |
| InChIKey | NZVQHNPIDDLHCY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|