C22H23FN2O — CID 17243849
4-(4-fluorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17243849) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17243849 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CCCNC(=O)c1cccc2c1NC(c1ccc(F)cc1)C1CC=CC21 |
| InChI | InChI=1S/C22H23FN2O/c1-2-13-24-22(26)19-8-4-7-18-16-5-3-6-17(16)20(25-21(18)19)14-9-11-15(23)12-10-14/h3-5,7-12,16-17,20,25H,2,6,13H2,1H3,(H,24,26) |
| InChIKey | MXZFSKFOQBAQCM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|