C26H31N3O — CID 17238927
4-[4-(diethylamino)phenyl]-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17238927) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-[4-(diethylamino)phenyl]-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17238927 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | C=CCNC(=O)c1cccc2c1NC(c1ccc(N(CC)CC)cc1)C1CC=CC21 |
| InChI | InChI=1S/C26H31N3O/c1-4-17-27-26(30)23-12-8-11-22-20-9-7-10-21(20)24(28-25(22)23)18-13-15-19(16-14-18)29(5-2)6-3/h4,7-9,11-16,20-21,24,28H,1,5-6,10,17H2,2-3H3,(H,27,30) |
| InChIKey | YXAZPBYBCATIMQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|