C22H22Cl2N2O2 — CID 17239714
4-(3,5-dichloro-2-hydroxyphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17239714) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-hydroxyphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(3,5-dichloro-2-hydroxyphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17239714 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4-(3,5-dichloro-2-hydroxyphenyl)-N-propyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CCCNC(=O)c1cccc2c1NC(c1cc(Cl)cc(Cl)c1O)C1CC=CC21 |
| InChI | InChI=1S/C22H22Cl2N2O2/c1-2-9-25-22(28)16-8-4-7-14-13-5-3-6-15(13)20(26-19(14)16)17-10-12(23)11-18(24)21(17)27/h3-5,7-8,10-11,13,15,20,26-27H,2,6,9H2,1H3,(H,25,28) |
| InChIKey | YNXAMIFHSZFXJY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|