C21H20Cl2N2O — CID 6979479
(3aS,4S,9bS)-4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 6979479) has the molecular formula C21H20Cl2N2O and a molecular weight of 387.31 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | (3aS,4S,9bS)-4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 6979479 |
| Molecular Formula | C21H20Cl2N2O |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (3aS,4S,9bS)-4-(2,4-dichlorophenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CN(C)C(=O)c1cccc2c1N[C@H](c1ccc(Cl)cc1Cl)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C21H20Cl2N2O/c1-25(2)21(26)17-8-4-7-15-13-5-3-6-14(13)19(24-20(15)17)16-10-9-12(22)11-18(16)23/h3-5,7-11,13-14,19,24H,6H2,1-2H3/t13-,14-,19-/m0/s1 |
| InChIKey | WGSSPYJLXXMWPV-NJSLBKSFSA-N |
| XLogP | 5.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|