C20H20FN — CID 126181352
(3aS,4S,9bR)-6-ethyl-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126181352) has the molecular formula C20H20FN and a molecular weight of 293.39 g/mol. Its IUPAC name is (3aS,4S,9bR)-6-ethyl-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bR)-6-ethyl-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126181352 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (3aS,4S,9bR)-6-ethyl-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCc1cccc2c1N[C@H](c1ccc(F)cc1)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C20H20FN/c1-2-13-5-3-7-17-16-6-4-8-18(16)20(22-19(13)17)14-9-11-15(21)12-10-14/h3-7,9-12,16,18,20,22H,2,8H2,1H3/t16-,18-,20+/m0/s1 |
| InChIKey | POSGFPKBZGVYGA-XKGZKEIXSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|