C27H25FN2O2 — CID 17243843
N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17243843) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17243843 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc3c2NC(c2ccc(F)cc2)C2CC=CC32)cc1 |
| InChI | InChI=1S/C27H25FN2O2/c1-2-32-20-15-13-19(14-16-20)29-27(31)24-8-4-7-23-21-5-3-6-22(21)25(30-26(23)24)17-9-11-18(28)12-10-17/h3-5,7-16,21-22,25,30H,2,6H2,1H3,(H,29,31) |
| InChIKey | IPJRDOCZDCCVOI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|