C27H24Cl2N2O2 — CID 17241315
4-(2,3-dichlorophenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17241315) has the molecular formula C27H24Cl2N2O2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(2,3-dichlorophenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17241315 |
| Molecular Formula | C27H24Cl2N2O2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-N-(4-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc3c2NC(c2cccc(Cl)c2Cl)C2CC=CC32)cc1 |
| InChI | InChI=1S/C27H24Cl2N2O2/c1-2-33-17-14-12-16(13-15-17)30-27(32)22-10-4-8-20-18-6-3-7-19(18)25(31-26(20)22)21-9-5-11-23(28)24(21)29/h3-6,8-15,18-19,25,31H,2,7H2,1H3,(H,30,32) |
| InChIKey | WDSITSOPKINXFT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|